C20H9Cl2F5N2O4 — CID 90835343
N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-N-hydroxy-2-(trifluoromethyl)dibenzofuran-1-carboxamide (PubChem CID 90835343) has the molecular formula C20H9Cl2F5N2O4 and a molecular weight of 507.20 g/mol. Its IUPAC name is N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-N-hydroxy-2-(trifluoromethyl)dibenzofuran-1-carboxamide.
| Compound Name | N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-N-hydroxy-2-(trifluoromethyl)dibenzofuran-1-carboxamide |
|---|---|
| PubChem CID | 90835343 |
| Molecular Formula | C20H9Cl2F5N2O4 |
| Molecular Weight | 507.20 g/mol |
| Exact Mass | 505.99 |
| IUPAC Name | N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-N-hydroxy-2-(trifluoromethyl)dibenzofuran-1-carboxamide |
| SMILES | O=C(c1c(C(F)(F)F)cc(OC(F)F)c2oc3ccccc3c12)N(O)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C20H9Cl2F5N2O4/c21-10-6-28-7-11(22)16(10)29(31)18(30)15-9(20(25,26)27)5-13(33-19(23)24)17-14(15)8-3-1-2-4-12(8)32-17/h1-7,19,31H |
| InChIKey | DYEFKJZUWGMFJL-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.20 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|