C20H13Cl2F2N3O6S — CID 91364495
N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-N-hydroxy-8-(methanesulfonamido)dibenzofuran-1-carboxamide (PubChem CID 91364495) has the molecular formula C20H13Cl2F2N3O6S and a molecular weight of 532.31 g/mol. Its IUPAC name is N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-N-hydroxy-8-(methanesulfonamido)dibenzofuran-1-carboxamide.
| Compound Name | N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-N-hydroxy-8-(methanesulfonamido)dibenzofuran-1-carboxamide |
|---|---|
| PubChem CID | 91364495 |
| Molecular Formula | C20H13Cl2F2N3O6S |
| Molecular Weight | 532.31 g/mol |
| Exact Mass | 530.99 |
| IUPAC Name | N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-N-hydroxy-8-(methanesulfonamido)dibenzofuran-1-carboxamide |
| SMILES | CS(=O)(=O)Nc1ccc2oc3c(OC(F)F)ccc(C(=O)N(O)c4c(Cl)cncc4Cl)c3c2c1 |
| InChI | InChI=1S/C20H13Cl2F2N3O6S/c1-34(30,31)26-9-2-4-14-11(6-9)16-10(3-5-15(18(16)32-14)33-20(23)24)19(28)27(29)17-12(21)7-25-8-13(17)22/h2-8,20,26,29H,1H3 |
| InChIKey | XBJLZRXSLCZKOF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 121.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.31 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|