C20H15Cl2N3O6S — CID 58867862
N-(3,5-dichloro-1-hydroxy-4-pyridinylidene)-8-(methanesulfonamido)-4-methoxydibenzofuran-1-carboxamide (PubChem CID 58867862) has the molecular formula C20H15Cl2N3O6S and a molecular weight of 496.33 g/mol. Its IUPAC name is N-(3,5-dichloro-1-hydroxy-4-pyridinylidene)-8-(methanesulfonamido)-4-methoxydibenzofuran-1-carboxamide.
| Compound Name | N-(3,5-dichloro-1-hydroxy-4-pyridinylidene)-8-(methanesulfonamido)-4-methoxydibenzofuran-1-carboxamide |
|---|---|
| PubChem CID | 58867862 |
| Molecular Formula | C20H15Cl2N3O6S |
| Molecular Weight | 496.33 g/mol |
| Exact Mass | 495.01 |
| IUPAC Name | N-(3,5-dichloro-1-hydroxy-4-pyridinylidene)-8-(methanesulfonamido)-4-methoxydibenzofuran-1-carboxamide |
| SMILES | COc1ccc(C(=O)N=c2c(Cl)cn(O)cc2Cl)c2c1oc1ccc(NS(C)(=O)=O)cc12 |
| InChI | InChI=1S/C20H15Cl2N3O6S/c1-30-16-6-4-11(20(26)23-18-13(21)8-25(27)9-14(18)22)17-12-7-10(24-32(2,28)29)3-5-15(12)31-19(16)17/h3-9,24,27H,1-2H3 |
| InChIKey | MSJGRKQGQQNJOT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|