C23H16Cl3F2N3O4 — CID 58867885
3-chloropropyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-(difluoromethoxy)dibenzofuran-2-yl]methanimidate (PubChem CID 58867885) has the molecular formula C23H16Cl3F2N3O4 and a molecular weight of 542.75 g/mol. Its IUPAC name is 3-chloropropyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-(difluoromethoxy)dibenzofuran-2-yl]methanimidate.
| Compound Name | 3-chloropropyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-(difluoromethoxy)dibenzofuran-2-yl]methanimidate |
|---|---|
| PubChem CID | 58867885 |
| Molecular Formula | C23H16Cl3F2N3O4 |
| Molecular Weight | 542.75 g/mol |
| Exact Mass | 541.02 |
| IUPAC Name | 3-chloropropyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-(difluoromethoxy)dibenzofuran-2-yl]methanimidate |
| SMILES | O=C(Nc1c(Cl)cncc1Cl)c1ccc(OC(F)F)c2oc3ccc(/N=C/OCCCCl)cc3c12 |
| InChI | InChI=1S/C23H16Cl3F2N3O4/c24-6-1-7-33-11-30-12-2-4-17-14(8-12)19-13(3-5-18(21(19)34-17)35-23(27)28)22(32)31-20-15(25)9-29-10-16(20)26/h2-5,8-11,23H,1,6-7H2,(H,29,31,32)/b30-11+ |
| InChIKey | YXUGKUCEYDDWRM-KNBZMSCYSA-N |
| XLogP | 7.45 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.75 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|