About 6-[(2-methylcyclopropyl)amino]hexylmercury;propane
6-[(2-methylcyclopropyl)amino]hexylmercury;propane (PubChem CID 143214043) has the molecular formula C13H28HgN
and a molecular weight of 398.96 g/mol. Its IUPAC name is 6-[(2-methylcyclopropyl)amino]hexylmercury;propane.
Molecular Properties
| Compound Name | 6-[(2-methylcyclopropyl)amino]hexylmercury;propane |
| PubChem CID | 143214043 |
| Molecular Formula | C13H28HgN |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 6-[(2-methylcyclopropyl)amino]hexylmercury;propane |
| SMILES | CC1CC1NCCCCCC[Hg].CCC |
| InChI | InChI=1S/C10H20N.C3H8.Hg/c1-3-4-5-6-7-11-10-8-9(10)2;1-3-2;/h9-11H,1,3-8H2,2H3;3H2,1-2H3; |
| InChIKey | TXIKVUZGSMZKAU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2-methylcyclopropyl)amino]hexylmercury;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2-methylcyclopropyl)amino]hexylmercury;propane?
The IUPAC name of 6-[(2-methylcyclopropyl)amino]hexylmercury;propane (CID 143214043) is 6-[(2-methylcyclopropyl)amino]hexylmercury;propane.
What is the SMILES notation for 6-[(2-methylcyclopropyl)amino]hexylmercury;propane?
The canonical SMILES for 6-[(2-methylcyclopropyl)amino]hexylmercury;propane is CC1CC1NCCCCCC[Hg].CCC.
What is the InChIKey of 6-[(2-methylcyclopropyl)amino]hexylmercury;propane?
The InChIKey is TXIKVUZGSMZKAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N.C3H8.Hg/c1-3-4-5-6-7-11-10-8-9(10)2;1-3-2;/h9-11H,1,3-8H2,2H3;3H2,1-2H3;.
What are the key properties of 6-[(2-methylcyclopropyl)amino]hexylmercury;propane?
6-[(2-methylcyclopropyl)amino]hexylmercury;propane has a molecular weight of 398.96 g/mol, XLogP of 3.93, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2-methylcyclopropyl)amino]hexylmercury;propane is sourced from PubChem (CID 143214043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).