About ethane;3-methylcyclopentane-1,2-diimine
ethane;3-methylcyclopentane-1,2-diimine (PubChem CID 143214230) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is ethane;3-methylcyclopentane-1,2-diimine.
Molecular Properties
| Compound Name | ethane;3-methylcyclopentane-1,2-diimine |
| PubChem CID | 143214230 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | ethane;3-methylcyclopentane-1,2-diimine |
| SMILES | CC.[H]/N=C1\CCC(C)\C1=N/[H] |
| InChI | InChI=1S/C6H10N2.C2H6/c1-4-2-3-5(7)6(4)8;1-2/h4,7-8H,2-3H2,1H3;1-2H3/b7-5+,8-6+; |
| InChIKey | GOKCHUBTXHOMOO-PUFOULASSA-N |
| XLogP | 2.48 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methylcyclopentane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylcyclopentane-1,2-diimine?
The IUPAC name of ethane;3-methylcyclopentane-1,2-diimine (CID 143214230) is ethane;3-methylcyclopentane-1,2-diimine.
What is the SMILES notation for ethane;3-methylcyclopentane-1,2-diimine?
The canonical SMILES for ethane;3-methylcyclopentane-1,2-diimine is CC.[H]/N=C1\CCC(C)\C1=N/[H].
What is the InChIKey of ethane;3-methylcyclopentane-1,2-diimine?
The InChIKey is GOKCHUBTXHOMOO-PUFOULASSA-N. The full InChI is InChI=1S/C6H10N2.C2H6/c1-4-2-3-5(7)6(4)8;1-2/h4,7-8H,2-3H2,1H3;1-2H3/b7-5+,8-6+;.
What are the key properties of ethane;3-methylcyclopentane-1,2-diimine?
ethane;3-methylcyclopentane-1,2-diimine has a molecular weight of 140.23 g/mol, XLogP of 2.48, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylcyclopentane-1,2-diimine is sourced from PubChem (CID 143214230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).