C22H34N2O3 — CID 143214864
(2R,3R)-2,3-dihydroxy-N-[(1R)-6-[(4-methylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide (PubChem CID 143214864) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxy-N-[(1R)-6-[(4-methylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide.
| Compound Name | (2R,3R)-2,3-dihydroxy-N-[(1R)-6-[(4-methylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide |
|---|---|
| PubChem CID | 143214864 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-N-[(1R)-6-[(4-methylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide |
| SMILES | CC[C@@H](O)[C@@H](O)C(=O)N[C@@H]1CCCc2cc(CN3CCC(C)CC3)ccc21 |
| InChI | InChI=1S/C22H34N2O3/c1-3-20(25)21(26)22(27)23-19-6-4-5-17-13-16(7-8-18(17)19)14-24-11-9-15(2)10-12-24/h7-8,13,15,19-21,25-26H,3-6,9-12,14H2,1-2H3,(H,23,27)/t19-,20-,21-/m1/s1 |
| InChIKey | LZWYSMRGJZAGRA-NJDAHSKKSA-N |
| XLogP | 2.54 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |