C19H27N3 — CID 14321567
4,5,6-tritert-butylpyridine-2,3-dicarbonitrile (PubChem CID 14321567) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is 4,5,6-tritert-butylpyridine-2,3-dicarbonitrile.
| Compound Name | 4,5,6-tritert-butylpyridine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 14321567 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 4,5,6-tritert-butylpyridine-2,3-dicarbonitrile |
| SMILES | CC(C)(C)c1nc(C#N)c(C#N)c(C(C)(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C19H27N3/c1-17(2,3)14-12(10-20)13(11-21)22-16(19(7,8)9)15(14)18(4,5)6/h1-9H3 |
| InChIKey | OMMPEMODKIEWSA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |