C11H19N3 — CID 143217239
2-[amino(propan-2-yl)amino]-4-methylcyclohepta-1,3,6-trien-1-amine (PubChem CID 143217239) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-[amino(propan-2-yl)amino]-4-methylcyclohepta-1,3,6-trien-1-amine.
| Compound Name | 2-[amino(propan-2-yl)amino]-4-methylcyclohepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 143217239 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2-[amino(propan-2-yl)amino]-4-methylcyclohepta-1,3,6-trien-1-amine |
| SMILES | CC1=CC(N(N)C(C)C)=C(N)C=CC1 |
| InChI | InChI=1S/C11H19N3/c1-8(2)14(13)11-7-9(3)5-4-6-10(11)12/h4,6-8H,5,12-13H2,1-3H3 |
| InChIKey | RGCRNTGOONDQLT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|