C13H25N3 — CID 118363217
(2Z,4E,5Z)-7-[amino(methyl)amino]-4-ethylidene-N-methylnona-2,5-dien-5-amine (PubChem CID 118363217) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is (2Z,4E,5Z)-7-[amino(methyl)amino]-4-ethylidene-N-methylnona-2,5-dien-5-amine.
| Compound Name | (2Z,4E,5Z)-7-[amino(methyl)amino]-4-ethylidene-N-methylnona-2,5-dien-5-amine |
|---|---|
| PubChem CID | 118363217 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | (2Z,4E,5Z)-7-[amino(methyl)amino]-4-ethylidene-N-methylnona-2,5-dien-5-amine |
| SMILES | C/C=C\C(=C/C)\C(=C\C(CC)N(C)N)NC |
| InChI | InChI=1S/C13H25N3/c1-6-9-11(7-2)13(15-4)10-12(8-3)16(5)14/h6-7,9-10,12,15H,8,14H2,1-5H3/b9-6-,11-7+,13-10- |
| InChIKey | ONBCKTMUGPABET-SXIWGXCUSA-N |
| XLogP | 2.20 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|