C19H22F5N3 — CID 143218063
5-[5-(6,7-difluorocyclohepta-1,4,6-trien-1-yl)hexyl]-3-[1-(trifluoromethyl)cyclopropyl]-1H-1,2,4-triazole (PubChem CID 143218063) has the molecular formula C19H22F5N3 and a molecular weight of 387.40 g/mol. Its IUPAC name is 5-[5-(6,7-difluorocyclohepta-1,4,6-trien-1-yl)hexyl]-3-[1-(trifluoromethyl)cyclopropyl]-1H-1,2,4-triazole.
| Compound Name | 5-[5-(6,7-difluorocyclohepta-1,4,6-trien-1-yl)hexyl]-3-[1-(trifluoromethyl)cyclopropyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 143218063 |
| Molecular Formula | C19H22F5N3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 5-[5-(6,7-difluorocyclohepta-1,4,6-trien-1-yl)hexyl]-3-[1-(trifluoromethyl)cyclopropyl]-1H-1,2,4-triazole |
| SMILES | CC(CCCCc1nc(C2(C(F)(F)F)CC2)n[nH]1)C1=CCC=CC(F)=C1F |
| InChI | InChI=1S/C19H22F5N3/c1-12(13-7-3-4-8-14(20)16(13)21)6-2-5-9-15-25-17(27-26-15)18(10-11-18)19(22,23)24/h4,7-8,12H,2-3,5-6,9-11H2,1H3,(H,25,26,27) |
| InChIKey | ZOZUOFIXIBDGOM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|