C22H35N3 — CID 142840529
5-heptyl-3-[1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]cyclopentyl]-1H-1,2,4-triazole (PubChem CID 142840529) has the molecular formula C22H35N3 and a molecular weight of 341.54 g/mol. Its IUPAC name is 5-heptyl-3-[1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]cyclopentyl]-1H-1,2,4-triazole.
| Compound Name | 5-heptyl-3-[1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]cyclopentyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 142840529 |
| Molecular Formula | C22H35N3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | 5-heptyl-3-[1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]cyclopentyl]-1H-1,2,4-triazole |
| SMILES | C=C/C(=C\C=C(C)C)C1(c2n[nH]c(CCCCCCC)n2)CCCC1 |
| InChI | InChI=1S/C22H35N3/c1-5-7-8-9-10-13-20-23-21(25-24-20)22(16-11-12-17-22)19(6-2)15-14-18(3)4/h6,14-15H,2,5,7-13,16-17H2,1,3-4H3,(H,23,24,25)/b19-15+ |
| InChIKey | GKDKCXXYQRLYBL-XDJHFCHBSA-N |
| XLogP | 6.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|