C16H18F5N3 — CID 143218128
3-[4-(5,7-difluorocyclohepta-1,3,5-trien-1-yl)pentyl]-5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole (PubChem CID 143218128) has the molecular formula C16H18F5N3 and a molecular weight of 347.33 g/mol. Its IUPAC name is 3-[4-(5,7-difluorocyclohepta-1,3,5-trien-1-yl)pentyl]-5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole.
| Compound Name | 3-[4-(5,7-difluorocyclohepta-1,3,5-trien-1-yl)pentyl]-5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 143218128 |
| Molecular Formula | C16H18F5N3 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 3-[4-(5,7-difluorocyclohepta-1,3,5-trien-1-yl)pentyl]-5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole |
| SMILES | CC(CCCc1n[nH]c(CC(F)(F)F)n1)C1=CC=CC(F)=CC1F |
| InChI | InChI=1S/C16H18F5N3/c1-10(12-6-3-5-11(17)8-13(12)18)4-2-7-14-22-15(24-23-14)9-16(19,20)21/h3,5-6,8,10,13H,2,4,7,9H2,1H3,(H,22,23,24) |
| InChIKey | CVJPFZJMZQOCGW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |