C26H45BrN4O2S — CID 143218547
N-(2-amino-3-methyl-2-bicyclo[2.2.1]heptanyl)formamide;1-[4-(2-bromo-5-methylphenyl)sulfanylpiperazin-1-yl]ethanone;ethane (PubChem CID 143218547) has the molecular formula C26H45BrN4O2S and a molecular weight of 557.64 g/mol. Its IUPAC name is N-(2-amino-3-methyl-2-bicyclo[2.2.1]heptanyl)formamide;1-[4-(2-bromo-5-methylphenyl)sulfanylpiperazin-1-yl]ethanone;ethane.
| Compound Name | N-(2-amino-3-methyl-2-bicyclo[2.2.1]heptanyl)formamide;1-[4-(2-bromo-5-methylphenyl)sulfanylpiperazin-1-yl]ethanone;ethane |
|---|---|
| PubChem CID | 143218547 |
| Molecular Formula | C26H45BrN4O2S |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | N-(2-amino-3-methyl-2-bicyclo[2.2.1]heptanyl)formamide;1-[4-(2-bromo-5-methylphenyl)sulfanylpiperazin-1-yl]ethanone;ethane |
| SMILES | CC.CC.CC(=O)N1CCN(Sc2cc(C)ccc2Br)CC1.CC1C2CCC(C2)C1(N)NC=O |
| InChI | InChI=1S/C13H17BrN2OS.C9H16N2O.2C2H6/c1-10-3-4-12(14)13(9-10)18-16-7-5-15(6-8-16)11(2)17;1-6-7-2-3-8(4-7)9(6,10)11-5-12;2*1-2/h3-4,9H,5-8H2,1-2H3;5-8H,2-4,10H2,1H3,(H,11,12);2*1-2H3 |
| InChIKey | NMQTUYVMYCMRPO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|