C18H21N3O4 — CID 143218974
2-[4-[3-(6-amino-2-methoxypyrimidin-4-yl)phenyl]oxan-4-yl]acetic acid (PubChem CID 143218974) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-[4-[3-(6-amino-2-methoxypyrimidin-4-yl)phenyl]oxan-4-yl]acetic acid.
| Compound Name | 2-[4-[3-(6-amino-2-methoxypyrimidin-4-yl)phenyl]oxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 143218974 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-[4-[3-(6-amino-2-methoxypyrimidin-4-yl)phenyl]oxan-4-yl]acetic acid |
| SMILES | COc1nc(N)cc(-c2cccc(C3(CC(=O)O)CCOCC3)c2)n1 |
| InChI | InChI=1S/C18H21N3O4/c1-24-17-20-14(10-15(19)21-17)12-3-2-4-13(9-12)18(11-16(22)23)5-7-25-8-6-18/h2-4,9-10H,5-8,11H2,1H3,(H,22,23)(H2,19,20,21) |
| InChIKey | ZNSYYPILAORYGX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |