C14H23FO — CID 143220169
1-[(2E,4Z)-6-fluorohepta-2,4-dien-3-yl]oxy-4-methylcyclohexane (PubChem CID 143220169) has the molecular formula C14H23FO and a molecular weight of 226.34 g/mol. Its IUPAC name is 1-[(2E,4Z)-6-fluorohepta-2,4-dien-3-yl]oxy-4-methylcyclohexane.
| Compound Name | 1-[(2E,4Z)-6-fluorohepta-2,4-dien-3-yl]oxy-4-methylcyclohexane |
|---|---|
| PubChem CID | 143220169 |
| Molecular Formula | C14H23FO |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-[(2E,4Z)-6-fluorohepta-2,4-dien-3-yl]oxy-4-methylcyclohexane |
| SMILES | C/C=C(\C=C/C(C)F)OC1CCC(C)CC1 |
| InChI | InChI=1S/C14H23FO/c1-4-13(10-7-12(3)15)16-14-8-5-11(2)6-9-14/h4,7,10-12,14H,5-6,8-9H2,1-3H3/b10-7-,13-4+ |
| InChIKey | KTWCCSBEQCXAIB-DJIRJURBSA-N |
| XLogP | 4.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|