C26H24F2N4O2 — CID 143222822
3-[6-ethanimidoyl-2-fluoro-3-[2-fluoro-4-(2-oxopiperidin-1-yl)phenyl]anilino]benzamide (PubChem CID 143222822) has the molecular formula C26H24F2N4O2 and a molecular weight of 462.50 g/mol. Its IUPAC name is 3-[6-ethanimidoyl-2-fluoro-3-[2-fluoro-4-(2-oxopiperidin-1-yl)phenyl]anilino]benzamide.
| Compound Name | 3-[6-ethanimidoyl-2-fluoro-3-[2-fluoro-4-(2-oxopiperidin-1-yl)phenyl]anilino]benzamide |
|---|---|
| PubChem CID | 143222822 |
| Molecular Formula | C26H24F2N4O2 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 3-[6-ethanimidoyl-2-fluoro-3-[2-fluoro-4-(2-oxopiperidin-1-yl)phenyl]anilino]benzamide |
| SMILES | [H]/N=C(/C)c1ccc(-c2ccc(N3CCCCC3=O)cc2F)c(F)c1Nc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C26H24F2N4O2/c1-15(29)19-10-11-21(24(28)25(19)31-17-6-4-5-16(13-17)26(30)34)20-9-8-18(14-22(20)27)32-12-3-2-7-23(32)33/h4-6,8-11,13-14,29,31H,2-3,7,12H2,1H3,(H2,30,34)/b29-15- |
| InChIKey | IVYMRBIQROOKRE-FDVSRXAVSA-N |
| XLogP | 5.38 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|