C22H19ClFN5O4 — CID 143223783
(1R)-1-N-(5-chloro-2-pyridinyl)cyclopropane-1,2-dicarboxamide;N-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]formamide (PubChem CID 143223783) has the molecular formula C22H19ClFN5O4 and a molecular weight of 471.88 g/mol. Its IUPAC name is (1R)-1-N-(5-chloro-2-pyridinyl)cyclopropane-1,2-dicarboxamide;N-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]formamide.
| Compound Name | (1R)-1-N-(5-chloro-2-pyridinyl)cyclopropane-1,2-dicarboxamide;N-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]formamide |
|---|---|
| PubChem CID | 143223783 |
| Molecular Formula | C22H19ClFN5O4 |
| Molecular Weight | 471.88 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | (1R)-1-N-(5-chloro-2-pyridinyl)cyclopropane-1,2-dicarboxamide;N-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]formamide |
| SMILES | NC(=O)C1C[C@H]1C(=O)Nc1ccc(Cl)cn1.O=CNc1ccc(-n2ccccc2=O)cc1F |
| InChI | InChI=1S/C12H9FN2O2.C10H10ClN3O2/c13-10-7-9(4-5-11(10)14-8-16)15-6-2-1-3-12(15)17;11-5-1-2-8(13-4-5)14-10(16)7-3-6(7)9(12)15/h1-8H,(H,14,16);1-2,4,6-7H,3H2,(H2,12,15)(H,13,14,16)/t;6?,7-/m.1/s1 |
| InChIKey | OENQZLXVDFLQMK-GLVYENHBSA-N |
| XLogP | 2.34 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.88 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|