C25H25ClFN3O5 — CID 143223895
N-(4-chlorophenyl)formamide;ethyl cyclopropanecarboxylate;N-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]formamide (PubChem CID 143223895) has the molecular formula C25H25ClFN3O5 and a molecular weight of 501.94 g/mol. Its IUPAC name is N-(4-chlorophenyl)formamide;ethyl cyclopropanecarboxylate;N-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]formamide.
| Compound Name | N-(4-chlorophenyl)formamide;ethyl cyclopropanecarboxylate;N-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]formamide |
|---|---|
| PubChem CID | 143223895 |
| Molecular Formula | C25H25ClFN3O5 |
| Molecular Weight | 501.94 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | N-(4-chlorophenyl)formamide;ethyl cyclopropanecarboxylate;N-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]formamide |
| SMILES | CCOC(=O)C1CC1.O=CNc1ccc(-n2ccccc2=O)cc1F.O=CNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H9FN2O2.C7H6ClNO.C6H10O2/c13-10-7-9(4-5-11(10)14-8-16)15-6-2-1-3-12(15)17;8-6-1-3-7(4-2-6)9-5-10;1-2-8-6(7)5-3-4-5/h1-8H,(H,14,16);1-5H,(H,9,10);5H,2-4H2,1H3 |
| InChIKey | YQBAUIPLXRBHRC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.94 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|