C23H24ClFN4O4 — CID 143223901
N-(4-chlorophenyl)formamide;cyclopropanecarboxamide;1-[3-fluoro-4-(hydroxymethylamino)phenyl]pyridin-2-one (PubChem CID 143223901) has the molecular formula C23H24ClFN4O4 and a molecular weight of 474.92 g/mol. Its IUPAC name is N-(4-chlorophenyl)formamide;cyclopropanecarboxamide;1-[3-fluoro-4-(hydroxymethylamino)phenyl]pyridin-2-one.
| Compound Name | N-(4-chlorophenyl)formamide;cyclopropanecarboxamide;1-[3-fluoro-4-(hydroxymethylamino)phenyl]pyridin-2-one |
|---|---|
| PubChem CID | 143223901 |
| Molecular Formula | C23H24ClFN4O4 |
| Molecular Weight | 474.92 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-(4-chlorophenyl)formamide;cyclopropanecarboxamide;1-[3-fluoro-4-(hydroxymethylamino)phenyl]pyridin-2-one |
| SMILES | NC(=O)C1CC1.O=CNc1ccc(Cl)cc1.O=c1ccccn1-c1ccc(NCO)c(F)c1 |
| InChI | InChI=1S/C12H11FN2O2.C7H6ClNO.C4H7NO/c13-10-7-9(4-5-11(10)14-8-16)15-6-2-1-3-12(15)17;8-6-1-3-7(4-2-6)9-5-10;5-4(6)3-1-2-3/h1-7,14,16H,8H2;1-5H,(H,9,10);3H,1-2H2,(H2,5,6) |
| InChIKey | IUDYTPKOXWWOOB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.92 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|