C19H36N2O — CID 143224253
2-[cyclohexyl(methyl)amino]acetamide;4-(2-methylpropyl)cyclohexene (PubChem CID 143224253) has the molecular formula C19H36N2O and a molecular weight of 308.51 g/mol. Its IUPAC name is 2-[cyclohexyl(methyl)amino]acetamide;4-(2-methylpropyl)cyclohexene.
| Compound Name | 2-[cyclohexyl(methyl)amino]acetamide;4-(2-methylpropyl)cyclohexene |
|---|---|
| PubChem CID | 143224253 |
| Molecular Formula | C19H36N2O |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.28 |
| IUPAC Name | 2-[cyclohexyl(methyl)amino]acetamide;4-(2-methylpropyl)cyclohexene |
| SMILES | CC(C)CC1CC=CCC1.CN(CC(N)=O)C1CCCCC1 |
| InChI | InChI=1S/C10H18.C9H18N2O/c1-9(2)8-10-6-4-3-5-7-10;1-11(7-9(10)12)8-5-3-2-4-6-8/h3-4,9-10H,5-8H2,1-2H3;8H,2-7H2,1H3,(H2,10,12) |
| InChIKey | KPWAWFAPPDTTLT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|