C18H34N4O5 — CID 143224705
tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-[4-(propanoylamino)butyl]carbamimidoyl]carbamate (PubChem CID 143224705) has the molecular formula C18H34N4O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-[4-(propanoylamino)butyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-[4-(propanoylamino)butyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 143224705 |
| Molecular Formula | C18H34N4O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-[4-(propanoylamino)butyl]carbamimidoyl]carbamate |
| SMILES | CCC(=O)NCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H34N4O5/c1-8-13(23)19-11-9-10-12-20-14(21-15(24)26-17(2,3)4)22-16(25)27-18(5,6)7/h8-12H2,1-7H3,(H,19,23)(H2,20,21,22,24,25) |
| InChIKey | BAOUDQVXJIJLMW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|