C32H60FN7O8 — CID 10556561
tert-butyl N-[3-[4-[[3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-fluoro-3-oxopropanoyl]amino]butylamino]propyl]carbamate (PubChem CID 10556561) has the molecular formula C32H60FN7O8 and a molecular weight of 689.87 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[[3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-fluoro-3-oxopropanoyl]amino]butylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[[3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-fluoro-3-oxopropanoyl]amino]butylamino]propyl]carbamate |
|---|---|
| PubChem CID | 10556561 |
| Molecular Formula | C32H60FN7O8 |
| Molecular Weight | 689.87 g/mol |
| Exact Mass | 689.45 |
| IUPAC Name | tert-butyl N-[3-[4-[[3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-fluoro-3-oxopropanoyl]amino]butylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNCCCCNC(=O)C(F)C(=O)NCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H60FN7O8/c1-30(2,3)46-27(43)38-22-16-18-34-17-14-15-20-36-25(42)23(33)24(41)35-19-12-10-11-13-21-37-26(39-28(44)47-31(4,5)6)40-29(45)48-32(7,8)9/h23,34H,10-22H2,1-9H3,(H,35,41)(H,36,42)(H,38,43)(H2,37,39,40,44,45) |
| InChIKey | RGPCZDUPTVWVMW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 197.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.87 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|