C35H66FN7O8 — CID 54554743
tert-butyl N-[4-[4-[[3-[8-[[N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-fluoroamino]octylamino]-3-oxopropanoyl]amino]butylamino]butan-2-yl]carbamate (PubChem CID 54554743) has the molecular formula C35H66FN7O8 and a molecular weight of 731.95 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[[3-[8-[[N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-fluoroamino]octylamino]-3-oxopropanoyl]amino]butylamino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[[3-[8-[[N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-fluoroamino]octylamino]-3-oxopropanoyl]amino]butylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 54554743 |
| Molecular Formula | C35H66FN7O8 |
| Molecular Weight | 731.95 g/mol |
| Exact Mass | 731.50 |
| IUPAC Name | tert-butyl N-[4-[4-[[3-[8-[[N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-fluoroamino]octylamino]-3-oxopropanoyl]amino]butylamino]butan-2-yl]carbamate |
| SMILES | CC(CCNCCCCNC(=O)CC(=O)NCCCCCCCCN(F)C(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H66FN7O8/c1-26(40-30(46)49-33(2,3)4)19-23-37-20-16-17-22-39-28(45)25-27(44)38-21-15-13-11-12-14-18-24-43(36)29(41-31(47)50-34(5,6)7)42-32(48)51-35(8,9)10/h26,37H,11-25H2,1-10H3,(H,38,44)(H,39,45)(H,40,46)(H,41,42,47,48) |
| InChIKey | ZMJRALLABBNTEA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 188.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.95 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|