C31H57N7O10 — CID 19000071
3-[4-[[3-[8-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]octylamino]-3-oxopropanoyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid (PubChem CID 19000071) has the molecular formula C31H57N7O10 and a molecular weight of 687.84 g/mol. Its IUPAC name is 3-[4-[[3-[8-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]octylamino]-3-oxopropanoyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid.
| Compound Name | 3-[4-[[3-[8-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]octylamino]-3-oxopropanoyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid |
|---|---|
| PubChem CID | 19000071 |
| Molecular Formula | C31H57N7O10 |
| Molecular Weight | 687.84 g/mol |
| Exact Mass | 687.42 |
| IUPAC Name | 3-[4-[[3-[8-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]octylamino]-3-oxopropanoyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid |
| SMILES | CC(C)(C)OC(=O)N/C(=N/CCCCCCCCNC(=O)CC(=O)NCCCCN(CCCNC(=O)O)C(=O)OC(C)(C)C)NC(=O)O |
| InChI | InChI=1S/C31H57N7O10/c1-30(2,3)47-28(45)37-25(36-27(43)44)34-18-12-10-8-7-9-11-16-32-23(39)22-24(40)33-17-13-14-20-38(21-15-19-35-26(41)42)29(46)48-31(4,5)6/h35H,7-22H2,1-6H3,(H,32,39)(H,33,40)(H,41,42)(H,43,44)(H2,34,36,37,45) |
| InChIKey | JWFKHCNOGPGYLE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 237.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.84 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|