C29H52FN7O10 — CID 19000087
3-[4-[[3-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-fluoro-3-oxopropanoyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid (PubChem CID 19000087) has the molecular formula C29H52FN7O10 and a molecular weight of 677.77 g/mol. Its IUPAC name is 3-[4-[[3-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-fluoro-3-oxopropanoyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid.
| Compound Name | 3-[4-[[3-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-fluoro-3-oxopropanoyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid |
|---|---|
| PubChem CID | 19000087 |
| Molecular Formula | C29H52FN7O10 |
| Molecular Weight | 677.77 g/mol |
| Exact Mass | 677.38 |
| IUPAC Name | 3-[4-[[3-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-fluoro-3-oxopropanoyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid |
| SMILES | CC(C)(C)OC(=O)N/C(=N/CCCCCCNC(=O)C(F)C(=O)NCCCCN(CCCNC(=O)O)C(=O)OC(C)(C)C)NC(=O)O |
| InChI | InChI=1S/C29H52FN7O10/c1-28(2,3)46-26(44)36-23(35-25(42)43)33-16-10-8-7-9-14-31-21(38)20(30)22(39)32-15-11-12-18-37(19-13-17-34-24(40)41)27(45)47-29(4,5)6/h20,34H,7-19H2,1-6H3,(H,31,38)(H,32,39)(H,40,41)(H,42,43)(H2,33,35,36,44) |
| InChIKey | QQIKPYATVULQGX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 237.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.77 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|