C20H35FN4O7 — CID 10718882
3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-fluoro-3-oxopropanoic acid (PubChem CID 10718882) has the molecular formula C20H35FN4O7 and a molecular weight of 462.52 g/mol. Its IUPAC name is 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-fluoro-3-oxopropanoic acid.
| Compound Name | 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-fluoro-3-oxopropanoic acid |
|---|---|
| PubChem CID | 10718882 |
| Molecular Formula | C20H35FN4O7 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-fluoro-3-oxopropanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCCCCNC(=O)C(F)C(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H35FN4O7/c1-19(2,3)31-17(29)24-16(25-18(30)32-20(4,5)6)23-12-10-8-7-9-11-22-14(26)13(21)15(27)28/h13H,7-12H2,1-6H3,(H,22,26)(H,27,28)(H2,23,24,25,29,30) |
| InChIKey | CITUCKNJJGSZBB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 155.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|