C22H40N4O7 — CID 10695782
ethyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoate (PubChem CID 10695782) has the molecular formula C22H40N4O7 and a molecular weight of 472.58 g/mol. Its IUPAC name is ethyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoate.
| Compound Name | ethyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 10695782 |
| Molecular Formula | C22H40N4O7 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | ethyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)NCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H40N4O7/c1-8-31-17(28)15-16(27)23-13-11-9-10-12-14-24-18(25-19(29)32-21(2,3)4)26-20(30)33-22(5,6)7/h8-15H2,1-7H3,(H,23,27)(H2,24,25,26,29,30) |
| InChIKey | XHNAIYJYKVQHMW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|