C16H28N4O7 — CID 19043090
3-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-3-oxopropanoic acid (PubChem CID 19043090) has the molecular formula C16H28N4O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is 3-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-3-oxopropanoic acid.
| Compound Name | 3-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 19043090 |
| Molecular Formula | C16H28N4O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 3-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-3-oxopropanoic acid |
| SMILES | CC(C)(C)OC(=O)N/C(=N/CCCCCCNC(=O)CC(=O)O)NC(=O)O |
| InChI | InChI=1S/C16H28N4O7/c1-16(2,3)27-15(26)20-13(19-14(24)25)18-9-7-5-4-6-8-17-11(21)10-12(22)23/h4-10H2,1-3H3,(H,17,21)(H,22,23)(H,24,25)(H2,18,19,20,26) |
| InChIKey | LVWBWZCPCHQHCN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 166.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|