C25H47N7O8 — CID 22873319
[N'-[6-[[3-[4-[[(3R)-3-(carboxyamino)butyl]amino]butylamino]-3-oxopropanoyl]amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid (PubChem CID 22873319) has the molecular formula C25H47N7O8 and a molecular weight of 573.69 g/mol. Its IUPAC name is [N'-[6-[[3-[4-[[(3R)-3-(carboxyamino)butyl]amino]butylamino]-3-oxopropanoyl]amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid.
| Compound Name | [N'-[6-[[3-[4-[[(3R)-3-(carboxyamino)butyl]amino]butylamino]-3-oxopropanoyl]amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid |
|---|---|
| PubChem CID | 22873319 |
| Molecular Formula | C25H47N7O8 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.35 |
| IUPAC Name | [N'-[6-[[3-[4-[[(3R)-3-(carboxyamino)butyl]amino]butylamino]-3-oxopropanoyl]amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid |
| SMILES | C[C@H](CCNCCCCNC(=O)CC(=O)NCCCCCC/N=C(\NC(=O)O)NC(=O)OC(C)(C)C)NC(=O)O |
| InChI | InChI=1S/C25H47N7O8/c1-18(30-22(35)36)11-16-26-12-9-10-14-28-20(34)17-19(33)27-13-7-5-6-8-15-29-21(31-23(37)38)32-24(39)40-25(2,3)4/h18,26,30H,5-17H2,1-4H3,(H,27,33)(H,28,34)(H,35,36)(H,37,38)(H2,29,31,32,39)/t18-/m1/s1 |
| InChIKey | SVRCQLAUMPIANJ-GOSISDBHSA-N |
| XLogP | 1.73 |
| TPSA | 219.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|