C31H56FN7O10 — CID 19000119
3-[4-[[3-[8-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]octylamino]-2-fluoro-3-oxopropanoyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid (PubChem CID 19000119) has the molecular formula C31H56FN7O10 and a molecular weight of 705.83 g/mol. Its IUPAC name is 3-[4-[[3-[8-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]octylamino]-2-fluoro-3-oxopropanoyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid.
| Compound Name | 3-[4-[[3-[8-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]octylamino]-2-fluoro-3-oxopropanoyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid |
|---|---|
| PubChem CID | 19000119 |
| Molecular Formula | C31H56FN7O10 |
| Molecular Weight | 705.83 g/mol |
| Exact Mass | 705.41 |
| IUPAC Name | 3-[4-[[3-[8-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]octylamino]-2-fluoro-3-oxopropanoyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid |
| SMILES | CC(C)(C)OC(=O)N/C(=N/CCCCCCCCNC(=O)C(F)C(=O)NCCCCN(CCCNC(=O)O)C(=O)OC(C)(C)C)NC(=O)O |
| InChI | InChI=1S/C31H56FN7O10/c1-30(2,3)48-28(46)38-25(37-27(44)45)35-18-12-10-8-7-9-11-16-33-23(40)22(32)24(41)34-17-13-14-20-39(21-15-19-36-26(42)43)29(47)49-31(4,5)6/h22,36H,7-21H2,1-6H3,(H,33,40)(H,34,41)(H,42,43)(H,44,45)(H2,35,37,38,46) |
| InChIKey | BKYUYDPVVXDFCJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 237.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.83 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|