C22H39FN4O7 — CID 10553079
ethyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-fluoro-3-oxopropanoate (PubChem CID 10553079) has the molecular formula C22H39FN4O7 and a molecular weight of 490.57 g/mol. Its IUPAC name is ethyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-fluoro-3-oxopropanoate.
| Compound Name | ethyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-fluoro-3-oxopropanoate |
|---|---|
| PubChem CID | 10553079 |
| Molecular Formula | C22H39FN4O7 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | ethyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-fluoro-3-oxopropanoate |
| SMILES | CCOC(=O)C(F)C(=O)NCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H39FN4O7/c1-8-32-17(29)15(23)16(28)24-13-11-9-10-12-14-25-18(26-19(30)33-21(2,3)4)27-20(31)34-22(5,6)7/h15H,8-14H2,1-7H3,(H,24,28)(H2,25,26,27,30,31) |
| InChIKey | ZEJPRIJDEWJXLW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|