C24H44N4O9 — CID 10530298
ethyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2,2-bis(hydroxymethyl)-3-oxopropanoate (PubChem CID 10530298) has the molecular formula C24H44N4O9 and a molecular weight of 532.64 g/mol. Its IUPAC name is ethyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2,2-bis(hydroxymethyl)-3-oxopropanoate.
| Compound Name | ethyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2,2-bis(hydroxymethyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 10530298 |
| Molecular Formula | C24H44N4O9 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | ethyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2,2-bis(hydroxymethyl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(CO)(CO)C(=O)NCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H44N4O9/c1-8-35-18(32)24(15-29,16-30)17(31)25-13-11-9-10-12-14-26-19(27-20(33)36-22(2,3)4)28-21(34)37-23(5,6)7/h29-30H,8-16H2,1-7H3,(H,25,31)(H2,26,27,28,33,34) |
| InChIKey | UMRHQABZAQYTGC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 184.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|