C18H32N4O7 — CID 19043150
3-[8-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]octylamino]-3-oxopropanoic acid (PubChem CID 19043150) has the molecular formula C18H32N4O7 and a molecular weight of 416.48 g/mol. Its IUPAC name is 3-[8-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]octylamino]-3-oxopropanoic acid.
| Compound Name | 3-[8-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]octylamino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 19043150 |
| Molecular Formula | C18H32N4O7 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 3-[8-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]octylamino]-3-oxopropanoic acid |
| SMILES | CC(C)(C)OC(=O)N/C(=N/CCCCCCCCNC(=O)CC(=O)O)NC(=O)O |
| InChI | InChI=1S/C18H32N4O7/c1-18(2,3)29-17(28)22-15(21-16(26)27)20-11-9-7-5-4-6-8-10-19-13(23)12-14(24)25/h4-12H2,1-3H3,(H,19,23)(H,24,25)(H,26,27)(H2,20,21,22,28) |
| InChIKey | CQBHGFWIZVRFMP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 166.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|