C24H43N5O8 — CID 10530238
ethyl 2-acetamido-3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoate (PubChem CID 10530238) has the molecular formula C24H43N5O8 and a molecular weight of 529.64 g/mol. Its IUPAC name is ethyl 2-acetamido-3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoate.
| Compound Name | ethyl 2-acetamido-3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 10530238 |
| Molecular Formula | C24H43N5O8 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | ethyl 2-acetamido-3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoate |
| SMILES | CCOC(=O)C(NC(C)=O)C(=O)NCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H43N5O8/c1-9-35-19(32)17(27-16(2)30)18(31)25-14-12-10-11-13-15-26-20(28-21(33)36-23(3,4)5)29-22(34)37-24(6,7)8/h17H,9-15H2,1-8H3,(H,25,31)(H,27,30)(H2,26,28,29,33,34) |
| InChIKey | MLORKDWFWTYTGV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 173.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|