C20H37N5O7 — CID 10671623
2-amino-3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoic acid (PubChem CID 10671623) has the molecular formula C20H37N5O7 and a molecular weight of 459.54 g/mol. Its IUPAC name is 2-amino-3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoic acid.
| Compound Name | 2-amino-3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 10671623 |
| Molecular Formula | C20H37N5O7 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | 2-amino-3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCCCCNC(=O)C(N)C(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37N5O7/c1-19(2,3)31-17(29)24-16(25-18(30)32-20(4,5)6)23-12-10-8-7-9-11-22-14(26)13(21)15(27)28/h13H,7-12,21H2,1-6H3,(H,22,26)(H,27,28)(H2,23,24,25,29,30) |
| InChIKey | MZZNDCNFKCYLTF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 181.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|