C22H39N5O8 — CID 10577358
2-acetamido-3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoic acid (PubChem CID 10577358) has the molecular formula C22H39N5O8 and a molecular weight of 501.58 g/mol. Its IUPAC name is 2-acetamido-3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoic acid.
| Compound Name | 2-acetamido-3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 10577358 |
| Molecular Formula | C22H39N5O8 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | 2-acetamido-3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoic acid |
| SMILES | CC(=O)NC(C(=O)O)C(=O)NCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H39N5O8/c1-14(28)25-15(17(30)31)16(29)23-12-10-8-9-11-13-24-18(26-19(32)34-21(2,3)4)27-20(33)35-22(5,6)7/h15H,8-13H2,1-7H3,(H,23,29)(H,25,28)(H,30,31)(H2,24,26,27,32,33) |
| InChIKey | JZNLUNKXRADENL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 184.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|