C24H45N7O8 — CID 19043110
[N'-[6-[[2-[4-[3-(carboxyamino)butylamino]butylamino]-2-oxoacetyl]amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid (PubChem CID 19043110) has the molecular formula C24H45N7O8 and a molecular weight of 559.67 g/mol. Its IUPAC name is [N'-[6-[[2-[4-[3-(carboxyamino)butylamino]butylamino]-2-oxoacetyl]amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid.
| Compound Name | [N'-[6-[[2-[4-[3-(carboxyamino)butylamino]butylamino]-2-oxoacetyl]amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid |
|---|---|
| PubChem CID | 19043110 |
| Molecular Formula | C24H45N7O8 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.33 |
| IUPAC Name | [N'-[6-[[2-[4-[3-(carboxyamino)butylamino]butylamino]-2-oxoacetyl]amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid |
| SMILES | CC(CCNCCCCNC(=O)C(=O)NCCCCCC/N=C(\NC(=O)O)NC(=O)OC(C)(C)C)NC(=O)O |
| InChI | InChI=1S/C24H45N7O8/c1-17(29-21(34)35)11-16-25-12-9-10-14-27-19(33)18(32)26-13-7-5-6-8-15-28-20(30-22(36)37)31-23(38)39-24(2,3)4/h17,25,29H,5-16H2,1-4H3,(H,26,32)(H,27,33)(H,34,35)(H,36,37)(H2,28,30,31,38) |
| InChIKey | MCKUADKHNGGANZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 219.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|