C23H42N4O8 — CID 10791580
ethyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-methoxy-3-oxopropanoate (PubChem CID 10791580) has the molecular formula C23H42N4O8 and a molecular weight of 502.61 g/mol. Its IUPAC name is ethyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-methoxy-3-oxopropanoate.
| Compound Name | ethyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-methoxy-3-oxopropanoate |
|---|---|
| PubChem CID | 10791580 |
| Molecular Formula | C23H42N4O8 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | ethyl 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-methoxy-3-oxopropanoate |
| SMILES | CCOC(=O)C(OC)C(=O)NCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H42N4O8/c1-9-33-18(29)16(32-8)17(28)24-14-12-10-11-13-15-25-19(26-20(30)34-22(2,3)4)27-21(31)35-23(5,6)7/h16H,9-15H2,1-8H3,(H,24,28)(H2,25,26,27,30,31) |
| InChIKey | QMNSKVDAPCKXQD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|