C17H30N4O8 — CID 19043163
3-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-methoxy-3-oxopropanoic acid (PubChem CID 19043163) has the molecular formula C17H30N4O8 and a molecular weight of 418.45 g/mol. Its IUPAC name is 3-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-methoxy-3-oxopropanoic acid.
| Compound Name | 3-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-methoxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 19043163 |
| Molecular Formula | C17H30N4O8 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 3-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-methoxy-3-oxopropanoic acid |
| SMILES | COC(C(=O)O)C(=O)NCCCCCC/N=C(\NC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30N4O8/c1-17(2,3)29-16(27)21-14(20-15(25)26)19-10-8-6-5-7-9-18-12(22)11(28-4)13(23)24/h11H,5-10H2,1-4H3,(H,18,22)(H,23,24)(H,25,26)(H2,19,20,21,27) |
| InChIKey | KZSTZTHJBZFCCZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 175.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|