C22H40N4O9 — CID 10625328
3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2,2-dimethoxy-3-oxopropanoic acid (PubChem CID 10625328) has the molecular formula C22H40N4O9 and a molecular weight of 504.58 g/mol. Its IUPAC name is 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2,2-dimethoxy-3-oxopropanoic acid.
| Compound Name | 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2,2-dimethoxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 10625328 |
| Molecular Formula | C22H40N4O9 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2,2-dimethoxy-3-oxopropanoic acid |
| SMILES | COC(OC)(C(=O)O)C(=O)NCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H40N4O9/c1-20(2,3)34-18(30)25-17(26-19(31)35-21(4,5)6)24-14-12-10-9-11-13-23-15(27)22(32-7,33-8)16(28)29/h9-14H2,1-8H3,(H,23,27)(H,28,29)(H2,24,25,26,30,31) |
| InChIKey | DJDPJLFSVCVDNE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 173.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|