C20H36N4O8 — CID 10623839
3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-hydroxy-3-oxopropanoic acid (PubChem CID 10623839) has the molecular formula C20H36N4O8 and a molecular weight of 460.53 g/mol. Its IUPAC name is 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-hydroxy-3-oxopropanoic acid.
| Compound Name | 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-hydroxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 10623839 |
| Molecular Formula | C20H36N4O8 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-hydroxy-3-oxopropanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCCCCNC(=O)C(O)C(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H36N4O8/c1-19(2,3)31-17(29)23-16(24-18(30)32-20(4,5)6)22-12-10-8-7-9-11-21-14(26)13(25)15(27)28/h13,25H,7-12H2,1-6H3,(H,21,26)(H,27,28)(H2,22,23,24,29,30) |
| InChIKey | OOZLLQJTRKIIMU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 175.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|