C30H55N7O11 — CID 19000124
3-[4-[[3-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-methoxy-3-oxopropanoyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid (PubChem CID 19000124) has the molecular formula C30H55N7O11 and a molecular weight of 689.81 g/mol. Its IUPAC name is 3-[4-[[3-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-methoxy-3-oxopropanoyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid.
| Compound Name | 3-[4-[[3-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-methoxy-3-oxopropanoyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid |
|---|---|
| PubChem CID | 19000124 |
| Molecular Formula | C30H55N7O11 |
| Molecular Weight | 689.81 g/mol |
| Exact Mass | 689.40 |
| IUPAC Name | 3-[4-[[3-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-methoxy-3-oxopropanoyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid |
| SMILES | COC(C(=O)NCCCCCC/N=C(\NC(=O)O)NC(=O)OC(C)(C)C)C(=O)NCCCCN(CCCNC(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H55N7O11/c1-29(2,3)47-27(44)36-24(35-26(42)43)33-17-11-9-8-10-15-31-22(38)21(46-7)23(39)32-16-12-13-19-37(20-14-18-34-25(40)41)28(45)48-30(4,5)6/h21,34H,8-20H2,1-7H3,(H,31,38)(H,32,39)(H,40,41)(H,42,43)(H2,33,35,36,44) |
| InChIKey | NUNMJQKFOAXSHI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 246.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.81 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|