C19H34N4O8 — CID 19043136
3-[8-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]octylamino]-2-methoxy-3-oxopropanoic acid (PubChem CID 19043136) has the molecular formula C19H34N4O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is 3-[8-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]octylamino]-2-methoxy-3-oxopropanoic acid.
| Compound Name | 3-[8-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]octylamino]-2-methoxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 19043136 |
| Molecular Formula | C19H34N4O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 3-[8-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]octylamino]-2-methoxy-3-oxopropanoic acid |
| SMILES | COC(C(=O)O)C(=O)NCCCCCCCC/N=C(\NC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H34N4O8/c1-19(2,3)31-18(29)23-16(22-17(27)28)21-12-10-8-6-5-7-9-11-20-14(24)13(30-4)15(25)26/h13H,5-12H2,1-4H3,(H,20,24)(H,25,26)(H,27,28)(H2,21,22,23,29) |
| InChIKey | SFASFYZYPLDVLV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 175.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|