C22H41N5O7 — CID 10624837
ethyl 2-amino-3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoate (PubChem CID 10624837) has the molecular formula C22H41N5O7 and a molecular weight of 487.60 g/mol. Its IUPAC name is ethyl 2-amino-3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoate.
| Compound Name | ethyl 2-amino-3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 10624837 |
| Molecular Formula | C22H41N5O7 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | ethyl 2-amino-3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-3-oxopropanoate |
| SMILES | CCOC(=O)C(N)C(=O)NCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H41N5O7/c1-8-32-17(29)15(23)16(28)24-13-11-9-10-12-14-25-18(26-19(30)33-21(2,3)4)27-20(31)34-22(5,6)7/h15H,8-14,23H2,1-7H3,(H,24,28)(H2,25,26,27,30,31) |
| InChIKey | YSFCTIVPFIBDJV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 170.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|