C16H27F3N4O5 — CID 15311265
tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-[3-[(2,2,2-trifluoroacetyl)amino]propyl]carbamimidoyl]carbamate (PubChem CID 15311265) has the molecular formula C16H27F3N4O5 and a molecular weight of 412.41 g/mol. Its IUPAC name is tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-[3-[(2,2,2-trifluoroacetyl)amino]propyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-[3-[(2,2,2-trifluoroacetyl)amino]propyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 15311265 |
| Molecular Formula | C16H27F3N4O5 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-[3-[(2,2,2-trifluoroacetyl)amino]propyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCNC(=O)C(F)(F)F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27F3N4O5/c1-14(2,3)27-12(25)22-11(23-13(26)28-15(4,5)6)21-9-7-8-20-10(24)16(17,18)19/h7-9H2,1-6H3,(H,20,24)(H2,21,22,23,25,26) |
| InChIKey | AHYVYHQDXQEIDV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|