C16H33F3IN5O2 — CID 111887498
tert-butyl N-[3-[[N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111887498) has the molecular formula C16H33F3IN5O2 and a molecular weight of 511.37 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111887498 |
| Molecular Formula | C16H33F3IN5O2 |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | tert-butyl N-[3-[[N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCCCN(C)CC(F)(F)F.I |
| InChI | InChI=1S/C16H32F3N5O2.HI/c1-15(2,3)26-14(25)23-9-6-8-21-13(20-4)22-10-7-11-24(5)12-16(17,18)19;/h6-12H2,1-5H3,(H,23,25)(H2,20,21,22);1H |
| InChIKey | MADRQTGMLZSUOK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|