C18H23FN2O — CID 143225134
4-fluoro-N,3-dimethylaniline;N-(4-propylphenyl)formamide (PubChem CID 143225134) has the molecular formula C18H23FN2O and a molecular weight of 302.39 g/mol. Its IUPAC name is 4-fluoro-N,3-dimethylaniline;N-(4-propylphenyl)formamide.
| Compound Name | 4-fluoro-N,3-dimethylaniline;N-(4-propylphenyl)formamide |
|---|---|
| PubChem CID | 143225134 |
| Molecular Formula | C18H23FN2O |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 4-fluoro-N,3-dimethylaniline;N-(4-propylphenyl)formamide |
| SMILES | CCCc1ccc(NC=O)cc1.CNc1ccc(F)c(C)c1 |
| InChI | InChI=1S/C10H13NO.C8H10FN/c1-2-3-9-4-6-10(7-5-9)11-8-12;1-6-5-7(10-2)3-4-8(6)9/h4-8H,2-3H2,1H3,(H,11,12);3-5,10H,1-2H3 |
| InChIKey | SDNNAABQEXIYEZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|