C33H52N6O7 — CID 143226607
2-[[(2R)-2-benzamido-4-methylpentanoyl]amino]-N-[(3S,4S)-1-[[(2S)-1-(ethylamino)-3-methyl-1-oxobutan-2-yl]amino]-3-hydroxy-6-methyl-1-oxooct-7-en-4-yl]butanediamide (PubChem CID 143226607) has the molecular formula C33H52N6O7 and a molecular weight of 644.81 g/mol. Its IUPAC name is 2-[[(2R)-2-benzamido-4-methylpentanoyl]amino]-N-[(3S,4S)-1-[[(2S)-1-(ethylamino)-3-methyl-1-oxobutan-2-yl]amino]-3-hydroxy-6-methyl-1-oxooct-7-en-4-yl]butanediamide.
| Compound Name | 2-[[(2R)-2-benzamido-4-methylpentanoyl]amino]-N-[(3S,4S)-1-[[(2S)-1-(ethylamino)-3-methyl-1-oxobutan-2-yl]amino]-3-hydroxy-6-methyl-1-oxooct-7-en-4-yl]butanediamide |
|---|---|
| PubChem CID | 143226607 |
| Molecular Formula | C33H52N6O7 |
| Molecular Weight | 644.81 g/mol |
| Exact Mass | 644.39 |
| IUPAC Name | 2-[[(2R)-2-benzamido-4-methylpentanoyl]amino]-N-[(3S,4S)-1-[[(2S)-1-(ethylamino)-3-methyl-1-oxobutan-2-yl]amino]-3-hydroxy-6-methyl-1-oxooct-7-en-4-yl]butanediamide |
| SMILES | C=CC(C)C[C@H](NC(=O)C(CC(N)=O)NC(=O)[C@@H](CC(C)C)NC(=O)c1ccccc1)[C@@H](O)CC(=O)N[C@H](C(=O)NCC)C(C)C |
| InChI | InChI=1S/C33H52N6O7/c1-8-21(7)16-23(26(40)18-28(42)39-29(20(5)6)33(46)35-9-2)36-32(45)25(17-27(34)41)38-31(44)24(15-19(3)4)37-30(43)22-13-11-10-12-14-22/h8,10-14,19-21,23-26,29,40H,1,9,15-18H2,2-7H3,(H2,34,41)(H,35,46)(H,36,45)(H,37,43)(H,38,44)(H,39,42)/t21?,23-,24+,25?,26-,29-/m0/s1 |
| InChIKey | HAJNLHFPXADZHH-RQSMFTCDSA-N |
| XLogP | 0.92 |
| TPSA | 208.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.81 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|