C21H32N6O6 — CID 15513626
N-[(2S)-1-[[(2S)-1-[[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-hydrazinyl-1,4-dioxobutan-2-yl]benzamide (PubChem CID 15513626) has the molecular formula C21H32N6O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-1-[[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-hydrazinyl-1,4-dioxobutan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-[[(2S)-1-[[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-hydrazinyl-1,4-dioxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 15513626 |
| Molecular Formula | C21H32N6O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | N-[(2S)-1-[[(2S)-1-[[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-hydrazinyl-1,4-dioxobutan-2-yl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(=O)NN)NC(=O)c1ccccc1)C(=O)N[C@H](C(N)=O)[C@@H](C)O |
| InChI | InChI=1S/C21H32N6O6/c1-11(2)9-14(21(33)26-17(12(3)28)18(22)30)25-20(32)15(10-16(29)27-23)24-19(31)13-7-5-4-6-8-13/h4-8,11-12,14-15,17,28H,9-10,23H2,1-3H3,(H2,22,30)(H,24,31)(H,25,32)(H,26,33)(H,27,29)/t12-,14+,15+,17+/m1/s1 |
| InChIKey | CHFMMISMOYIVOV-DYWXZXKOSA-N |
| XLogP | -1.95 |
| TPSA | 205.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|